C17H26N4O3S — CID 111141599
N-[4-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 111141599) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[4-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111141599 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[4-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)C(C)C)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N4O3S/c1-12(2)16(22)20-14-6-4-13(5-7-14)10-19-17(18-3)21-15-8-9-25(23,24)11-15/h4-7,12,15H,8-11H2,1-3H3,(H,20,22)(H2,18,19,21) |
| InChIKey | IDDMADPHVGUQOL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|