C22H36IN5O — CID 111918254
N-[4-[[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide (PubChem CID 111918254) has the molecular formula C22H36IN5O and a molecular weight of 513.47 g/mol. Its IUPAC name is N-[4-[[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[4-[[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111918254 |
| Molecular Formula | C22H36IN5O |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-[4-[[[N-(1-cyclopentylpyrrolidin-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)C(C)C)cc1)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C22H35N5O.HI/c1-16(2)21(28)25-18-10-8-17(9-11-18)14-24-22(23-3)26-19-12-13-27(15-19)20-6-4-5-7-20;/h8-11,16,19-20H,4-7,12-15H2,1-3H3,(H,25,28)(H2,23,24,26);1H |
| InChIKey | NXLCUHCUCHHRRC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|