C21H33N5O2S — CID 111919381
1-(1-cyclopentylpyrrolidin-3-yl)-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111919381) has the molecular formula C21H33N5O2S and a molecular weight of 419.60 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111919381 |
| Molecular Formula | C21H33N5O2S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)NC2CC2)cc1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C21H33N5O2S/c1-22-21(24-18-12-13-26(15-18)19-4-2-3-5-19)23-14-16-6-10-20(11-7-16)29(27,28)25-17-8-9-17/h6-7,10-11,17-19,25H,2-5,8-9,12-15H2,1H3,(H2,22,23,24) |
| InChIKey | YPEJLRLYWTZGDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|