C19H31N5O2S — CID 111918333
1-[2-(benzenesulfonamido)ethyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine (PubChem CID 111918333) has the molecular formula C19H31N5O2S and a molecular weight of 393.56 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111918333 |
| Molecular Formula | C19H31N5O2S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1ccccc1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C19H31N5O2S/c1-20-19(23-16-11-14-24(15-16)17-7-5-6-8-17)21-12-13-22-27(25,26)18-9-3-2-4-10-18/h2-4,9-10,16-17,22H,5-8,11-15H2,1H3,(H2,20,21,23) |
| InChIKey | ZASIAARCCWGHFI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|