C23H38IN5O2S — CID 111919884
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111919884) has the molecular formula C23H38IN5O2S and a molecular weight of 575.56 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111919884 |
| Molecular Formula | C23H38IN5O2S |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-(1-cyclopentylpyrrolidin-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(S(=O)(=O)c2ccccc2)CC1)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C23H37N5O2S.HI/c1-24-23(26-20-13-14-27(18-20)21-7-5-6-8-21)25-17-19-11-15-28(16-12-19)31(29,30)22-9-3-2-4-10-22;/h2-4,9-10,19-21H,5-8,11-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | NBTPELHKTBFDIX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|