C18H29N5O2S — CID 111919625
1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111919625) has the molecular formula C18H29N5O2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111919625 |
| Molecular Formula | C18H29N5O2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(S(N)(=O)=O)c1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C18H29N5O2S/c1-20-18(21-12-14-5-4-8-17(11-14)26(19,24)25)22-15-9-10-23(13-15)16-6-2-3-7-16/h4-5,8,11,15-16H,2-3,6-7,9-10,12-13H2,1H3,(H2,19,24,25)(H2,20,21,22) |
| InChIKey | DRYGYNCWWDMMBP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|