C17H33N5O2S — CID 109393894
1-(1-cyclopropylpiperidin-4-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 109393894) has the molecular formula C17H33N5O2S and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-(1-cyclopropylpiperidin-4-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-(1-cyclopropylpiperidin-4-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109393894 |
| Molecular Formula | C17H33N5O2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1-(1-cyclopropylpiperidin-4-yl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCN(S(C)(=O)=O)CC1)NC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C17H33N5O2S/c1-18-17(20-15-7-9-21(10-8-15)16-3-4-16)19-13-14-5-11-22(12-6-14)25(2,23)24/h14-16H,3-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | CZPOGZJVBHJJBH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|