C12H27IN4O3S — CID 110940713
1-(2-methoxyethyl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 110940713) has the molecular formula C12H27IN4O3S and a molecular weight of 434.34 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110940713 |
| Molecular Formula | C12H27IN4O3S |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-(2-methoxyethyl)-2-methyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)NCC1CCN(S(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C12H26N4O3S.HI/c1-13-12(14-6-9-19-2)15-10-11-4-7-16(8-5-11)20(3,17)18;/h11H,4-10H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | VXRYXWXCCHXWKB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|