C12H24F3IN4O4S2 — CID 111559255
2-methyl-1-(2-methylsulfonylethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111559255) has the molecular formula C12H24F3IN4O4S2 and a molecular weight of 536.38 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfonylethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylsulfonylethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111559255 |
| Molecular Formula | C12H24F3IN4O4S2 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-methyl-1-(2-methylsulfonylethyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C12H23F3N4O4S2.HI/c1-16-11(17-5-8-24(2,20)21)18-9-10-3-6-19(7-4-10)25(22,23)12(13,14)15;/h10H,3-9H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | JIMXFFWPODTZNZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|