C14H28F3IN4O3S — CID 111559239
1-(3-ethoxypropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111559239) has the molecular formula C14H28F3IN4O3S and a molecular weight of 516.37 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111559239 |
| Molecular Formula | C14H28F3IN4O3S |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C14H27F3N4O3S.HI/c1-3-24-10-4-7-19-13(18-2)20-11-12-5-8-21(9-6-12)25(22,23)14(15,16)17;/h12H,3-11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | UWKIVRSMJGRYQM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|