C17H33F3IN5O2S — CID 111559899
1-[2-(azepan-1-yl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111559899) has the molecular formula C17H33F3IN5O2S and a molecular weight of 555.45 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(azepan-1-yl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111559899 |
| Molecular Formula | C17H33F3IN5O2S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 1-[2-(azepan-1-yl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCCCCC1)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H32F3N5O2S.HI/c1-21-16(22-8-13-24-9-4-2-3-5-10-24)23-14-15-6-11-25(12-7-15)28(26,27)17(18,19)20;/h15H,2-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | SURXEUFROSAPLW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|