C17H36IN5O4S — CID 111885840
tert-butyl N-[3-[[N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111885840) has the molecular formula C17H36IN5O4S and a molecular weight of 533.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885840 |
| Molecular Formula | C17H36IN5O4S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC1CCN(S(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C17H35N5O4S.HI/c1-17(2,3)26-16(23)20-10-6-9-19-15(18-4)21-13-14-7-11-22(12-8-14)27(5,24)25;/h14H,6-13H2,1-5H3,(H,20,23)(H2,18,19,21);1H |
| InChIKey | NZCHKJWJQUYEAF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|