C17H35N5O2 — CID 111885821
tert-butyl N-[3-[[N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111885821) has the molecular formula C17H35N5O2 and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111885821 |
| Molecular Formula | C17H35N5O2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | tert-butyl N-[3-[[N-[(1-ethylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN1CCC(CN/C(=N/C)NCCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H35N5O2/c1-6-22-11-8-14(13-22)12-21-15(18-5)19-9-7-10-20-16(23)24-17(2,3)4/h14H,6-13H2,1-5H3,(H,20,23)(H2,18,19,21) |
| InChIKey | XVVXKXWKPBJIIH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|