C21H42IN5O4 — CID 111887554
tert-butyl 3-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111887554) has the molecular formula C21H42IN5O4 and a molecular weight of 555.50 g/mol. Its IUPAC name is tert-butyl 3-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111887554 |
| Molecular Formula | C21H42IN5O4 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | tert-butyl 3-[[[N'-methyl-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC1CCCN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H41N5O4.HI/c1-20(2,3)29-18(27)24-12-9-11-23-17(22-7)25-14-16-10-8-13-26(15-16)19(28)30-21(4,5)6;/h16H,8-15H2,1-7H3,(H,24,27)(H2,22,23,25);1H |
| InChIKey | PJZBQTWDQRBAOO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|