C13H24N2O4 — CID 141463922
methyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-1-carboxylate (PubChem CID 141463922) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-1-carboxylate.
| Compound Name | methyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141463922 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | methyl 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H24N2O4/c1-13(2,3)19-11(16)14-8-10-6-5-7-15(9-10)12(17)18-4/h10H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | YYPMDRAPRKDMOV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |