C20H34N2O3 — CID 86953035
tert-butyl N-[[1-[2-(4-methylcyclohexylidene)acetyl]piperidin-3-yl]methyl]carbamate (PubChem CID 86953035) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-(4-methylcyclohexylidene)acetyl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-(4-methylcyclohexylidene)acetyl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 86953035 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl N-[[1-[2-(4-methylcyclohexylidene)acetyl]piperidin-3-yl]methyl]carbamate |
| SMILES | CC1CCC(=CC(=O)N2CCCC(CNC(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C20H34N2O3/c1-15-7-9-16(10-8-15)12-18(23)22-11-5-6-17(14-22)13-21-19(24)25-20(2,3)4/h12,15,17H,5-11,13-14H2,1-4H3,(H,21,24)/b16-12- |
| InChIKey | SIPOFEUXUWZSEH-VBKFSLOCSA-N |
| XLogP | 3.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|