C20H29ClN2O3 — CID 23590478
tert-butyl N-[[1-[3-(4-chlorophenyl)propanoyl]piperidin-3-yl]methyl]carbamate (PubChem CID 23590478) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-(4-chlorophenyl)propanoyl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[3-(4-chlorophenyl)propanoyl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 23590478 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl N-[[1-[3-(4-chlorophenyl)propanoyl]piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(C(=O)CCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H29ClN2O3/c1-20(2,3)26-19(25)22-13-16-5-4-12-23(14-16)18(24)11-8-15-6-9-17(21)10-7-15/h6-7,9-10,16H,4-5,8,11-14H2,1-3H3,(H,22,25) |
| InChIKey | PKICJYIYJXEDJS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |