C18H24F2N2O3 — CID 97007691
tert-butyl N-[[(3R)-1-(2,6-difluorobenzoyl)piperidin-3-yl]methyl]carbamate (PubChem CID 97007691) has the molecular formula C18H24F2N2O3 and a molecular weight of 354.40 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-(2,6-difluorobenzoyl)piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-(2,6-difluorobenzoyl)piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 97007691 |
| Molecular Formula | C18H24F2N2O3 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | tert-butyl N-[[(3R)-1-(2,6-difluorobenzoyl)piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCCN(C(=O)c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C18H24F2N2O3/c1-18(2,3)25-17(24)21-10-12-6-5-9-22(11-12)16(23)15-13(19)7-4-8-14(15)20/h4,7-8,12H,5-6,9-11H2,1-3H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | XQTGMMSXTHRADA-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |