C22H33N3O4 — CID 108916489
tert-butyl N-[2-oxo-2-[[1-(3-phenylpropanoyl)piperidin-4-yl]methylamino]ethyl]carbamate (PubChem CID 108916489) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[[1-(3-phenylpropanoyl)piperidin-4-yl]methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[[1-(3-phenylpropanoyl)piperidin-4-yl]methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108916489 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[[1-(3-phenylpropanoyl)piperidin-4-yl]methylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N3O4/c1-22(2,3)29-21(28)24-16-19(26)23-15-18-11-13-25(14-12-18)20(27)10-9-17-7-5-4-6-8-17/h4-8,18H,9-16H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | ILSMNAKNKJTJAR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |