C23H30N4O6 — CID 108916401
tert-butyl N-[2-[[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate (PubChem CID 108916401) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916401 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC1CCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H30N4O6/c1-23(2,3)33-22(32)25-13-18(28)24-12-15-8-10-26(11-9-15)19(29)14-27-20(30)16-6-4-5-7-17(16)21(27)31/h4-7,15H,8-14H2,1-3H3,(H,24,28)(H,25,32) |
| InChIKey | FNLAAAKVWDLSET-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|