C22H30FN3O4 — CID 108916637
tert-butyl N-[2-[[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate (PubChem CID 108916637) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916637 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl N-[2-[[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC1CCN(C(=O)/C=C/c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H30FN3O4/c1-22(2,3)30-21(29)25-15-19(27)24-14-16-10-12-26(13-11-16)20(28)9-8-17-6-4-5-7-18(17)23/h4-9,16H,10-15H2,1-3H3,(H,24,27)(H,25,29)/b9-8+ |
| InChIKey | GXIQTXCHIZBUKH-CMDGGOBGSA-N |
| XLogP | 2.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|