C22H32N4O5 — CID 108916455
tert-butyl N-[2-[[1-(3-acetamidobenzoyl)piperidin-4-yl]methylamino]-2-oxoethyl]carbamate (PubChem CID 108916455) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3-acetamidobenzoyl)piperidin-4-yl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3-acetamidobenzoyl)piperidin-4-yl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916455 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl N-[2-[[1-(3-acetamidobenzoyl)piperidin-4-yl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CC(=O)Nc1cccc(C(=O)N2CCC(CNC(=O)CNC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H32N4O5/c1-15(27)25-18-7-5-6-17(12-18)20(29)26-10-8-16(9-11-26)13-23-19(28)14-24-21(30)31-22(2,3)4/h5-7,12,16H,8-11,13-14H2,1-4H3,(H,23,28)(H,24,30)(H,25,27) |
| InChIKey | AQMXISMBPIFHAI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |