C22H27BrN2O3 — CID 171396385
tert-butyl N-[[1-(5-bromonaphthalene-2-carbonyl)piperidin-4-yl]methyl]carbamate (PubChem CID 171396385) has the molecular formula C22H27BrN2O3 and a molecular weight of 447.37 g/mol. Its IUPAC name is tert-butyl N-[[1-(5-bromonaphthalene-2-carbonyl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(5-bromonaphthalene-2-carbonyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171396385 |
| Molecular Formula | C22H27BrN2O3 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | tert-butyl N-[[1-(5-bromonaphthalene-2-carbonyl)piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(C(=O)c2ccc3c(Br)cccc3c2)CC1 |
| InChI | InChI=1S/C22H27BrN2O3/c1-22(2,3)28-21(27)24-14-15-9-11-25(12-10-15)20(26)17-7-8-18-16(13-17)5-4-6-19(18)23/h4-8,13,15H,9-12,14H2,1-3H3,(H,24,27) |
| InChIKey | KGFXQHXQVKYENM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |