C27H35N3O4 — CID 108919215
tert-butyl N-[3-oxo-3-[[1-(4-phenylbenzoyl)piperidin-4-yl]methylamino]propyl]carbamate (PubChem CID 108919215) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[1-(4-phenylbenzoyl)piperidin-4-yl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[1-(4-phenylbenzoyl)piperidin-4-yl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108919215 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[1-(4-phenylbenzoyl)piperidin-4-yl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCC1CCN(C(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H35N3O4/c1-27(2,3)34-26(33)28-16-13-24(31)29-19-20-14-17-30(18-15-20)25(32)23-11-9-22(10-12-23)21-7-5-4-6-8-21/h4-12,20H,13-19H2,1-3H3,(H,28,33)(H,29,31) |
| InChIKey | PWVMVMRDJFWWAF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |