C21H28F3N3O4 — CID 108919405
tert-butyl N-[3-oxo-3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]methylamino]propyl]carbamate (PubChem CID 108919405) has the molecular formula C21H28F3N3O4 and a molecular weight of 443.47 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108919405 |
| Molecular Formula | C21H28F3N3O4 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCC1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H28F3N3O4/c1-21(2,3)31-20(30)25-9-6-16(28)26-12-13-7-10-27(11-8-13)19(29)14-4-5-15(22)18(24)17(14)23/h4-5,13H,6-12H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | PDCRRYBBWVGVNQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|