C25H33N3O4 — CID 171933146
tert-butyl N-[[1-(3-amino-4-phenylmethoxybenzoyl)piperidin-4-yl]methyl]carbamate (PubChem CID 171933146) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-amino-4-phenylmethoxybenzoyl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(3-amino-4-phenylmethoxybenzoyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171933146 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl N-[[1-(3-amino-4-phenylmethoxybenzoyl)piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(C(=O)c2ccc(OCc3ccccc3)c(N)c2)CC1 |
| InChI | InChI=1S/C25H33N3O4/c1-25(2,3)32-24(30)27-16-18-11-13-28(14-12-18)23(29)20-9-10-22(21(26)15-20)31-17-19-7-5-4-6-8-19/h4-10,15,18H,11-14,16-17,26H2,1-3H3,(H,27,30) |
| InChIKey | OMSATXYSODJHGM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|