C24H31N3O4 — CID 171933156
tert-butyl (2S)-4-(3-amino-4-phenylmethoxybenzoyl)-2-methylpiperazine-1-carboxylate (PubChem CID 171933156) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3-amino-4-phenylmethoxybenzoyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(3-amino-4-phenylmethoxybenzoyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 171933156 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl (2S)-4-(3-amino-4-phenylmethoxybenzoyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)c2ccc(OCc3ccccc3)c(N)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31N3O4/c1-17-15-26(12-13-27(17)23(29)31-24(2,3)4)22(28)19-10-11-21(20(25)14-19)30-16-18-8-6-5-7-9-18/h5-11,14,17H,12-13,15-16,25H2,1-4H3/t17-/m0/s1 |
| InChIKey | GLADJUCFOPJFPS-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|