C18H23BrF2N2O3 — CID 170918959
tert-butyl (2S)-4-[4-bromo-3-(difluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate (PubChem CID 170918959) has the molecular formula C18H23BrF2N2O3 and a molecular weight of 433.29 g/mol. Its IUPAC name is tert-butyl (2S)-4-[4-bromo-3-(difluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[4-bromo-3-(difluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170918959 |
| Molecular Formula | C18H23BrF2N2O3 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | tert-butyl (2S)-4-[4-bromo-3-(difluoromethyl)benzoyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)c2ccc(Br)c(C(F)F)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23BrF2N2O3/c1-11-10-22(7-8-23(11)17(25)26-18(2,3)4)16(24)12-5-6-14(19)13(9-12)15(20)21/h5-6,9,11,15H,7-8,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | PLEQKGOXGYGBMC-NSHDSACASA-N |
| XLogP | 4.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |