C17H21BrClFN2O3 — CID 176730218
tert-butyl (2R)-4-(4-bromo-2-chloro-5-fluorobenzoyl)-2-methylpiperazine-1-carboxylate (PubChem CID 176730218) has the molecular formula C17H21BrClFN2O3 and a molecular weight of 435.72 g/mol. Its IUPAC name is tert-butyl (2R)-4-(4-bromo-2-chloro-5-fluorobenzoyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(4-bromo-2-chloro-5-fluorobenzoyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 176730218 |
| Molecular Formula | C17H21BrClFN2O3 |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | tert-butyl (2R)-4-(4-bromo-2-chloro-5-fluorobenzoyl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)c2cc(F)c(Br)cc2Cl)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21BrClFN2O3/c1-10-9-21(5-6-22(10)16(24)25-17(2,3)4)15(23)11-7-14(20)12(18)8-13(11)19/h7-8,10H,5-6,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | RCXKKYRTJTUBFM-SNVBAGLBSA-N |
| XLogP | 4.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|