C12H13BrClFN2O — CID 176730225
(4-bromo-2-chloro-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone (PubChem CID 176730225) has the molecular formula C12H13BrClFN2O and a molecular weight of 335.60 g/mol. Its IUPAC name is (4-bromo-2-chloro-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone.
| Compound Name | (4-bromo-2-chloro-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 176730225 |
| Molecular Formula | C12H13BrClFN2O |
| Molecular Weight | 335.60 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | (4-bromo-2-chloro-5-fluorophenyl)-(3-methylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(F)c(Br)cc2Cl)CCN1 |
| InChI | InChI=1S/C12H13BrClFN2O/c1-7-6-17(3-2-16-7)12(18)8-4-11(15)9(13)5-10(8)14/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | CZAICKPMYGRKTK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|