C11H9BrClF2NO — CID 176730179
(4-bromo-2-chloro-5-fluorophenyl)-[(3S)-3-fluoropyrrolidin-1-yl]methanone (PubChem CID 176730179) has the molecular formula C11H9BrClF2NO and a molecular weight of 324.55 g/mol. Its IUPAC name is (4-bromo-2-chloro-5-fluorophenyl)-[(3S)-3-fluoropyrrolidin-1-yl]methanone.
| Compound Name | (4-bromo-2-chloro-5-fluorophenyl)-[(3S)-3-fluoropyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 176730179 |
| Molecular Formula | C11H9BrClF2NO |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | (4-bromo-2-chloro-5-fluorophenyl)-[(3S)-3-fluoropyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(Br)cc1Cl)N1CC[C@H](F)C1 |
| InChI | InChI=1S/C11H9BrClF2NO/c12-8-4-9(13)7(3-10(8)15)11(17)16-2-1-6(14)5-16/h3-4,6H,1-2,5H2/t6-/m0/s1 |
| InChIKey | CSMQVOHPVFXVQW-LURJTMIESA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|