About [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide
[(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 125173276) has the molecular formula C12H13ClF2N2O3S
and a molecular weight of 338.76 g/mol. Its IUPAC name is [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 125173276 |
| Molecular Formula | C12H13ClF2N2O3S |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)C[C@H]1CCN(C(=O)c2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C12H13ClF2N2O3S/c13-9-4-11(15)10(14)3-8(9)12(18)17-2-1-7(5-17)6-21(16,19)20/h3-4,7H,1-2,5-6H2,(H2,16,19,20)/t7-/m0/s1 |
| InChIKey | AHONVIMJPCFGAI-ZETCQYMHSA-N |
| XLogP | 1.37 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide (CID 125173276) is [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide is NS(=O)(=O)C[C@H]1CCN(C(=O)c2cc(F)c(F)cc2Cl)C1.
What is the InChIKey of [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide?
The InChIKey is AHONVIMJPCFGAI-ZETCQYMHSA-N. The full InChI is InChI=1S/C12H13ClF2N2O3S/c13-9-4-11(15)10(14)3-8(9)12(18)17-2-1-7(5-17)6-21(16,19)20/h3-4,7H,1-2,5-6H2,(H2,16,19,20)/t7-/m0/s1.
What are the key properties of [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide?
[(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide has a molecular weight of 338.76 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-(2-chloro-4,5-difluorobenzoyl)pyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 125173276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).