C12H12Cl2FNO2 — CID 62371519
(2,4-dichloro-5-fluorophenyl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 62371519) has the molecular formula C12H12Cl2FNO2 and a molecular weight of 292.14 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 62371519 |
| Molecular Formula | C12H12Cl2FNO2 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1Cl)N1CCC(CO)C1 |
| InChI | InChI=1S/C12H12Cl2FNO2/c13-9-4-10(14)11(15)3-8(9)12(18)16-2-1-7(5-16)6-17/h3-4,7,17H,1-2,5-6H2 |
| InChIKey | VLDAOXUEDKCJRL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|