C12H11F4NO2 — CID 55065222
[3-(hydroxymethyl)pyrrolidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 55065222) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is [3-(hydroxymethyl)pyrrolidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [3-(hydroxymethyl)pyrrolidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 55065222 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | [3-(hydroxymethyl)pyrrolidin-1-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCC(CO)C1 |
| InChI | InChI=1S/C12H11F4NO2/c13-8-3-7(9(14)11(16)10(8)15)12(19)17-2-1-6(4-17)5-18/h3,6,18H,1-2,4-5H2 |
| InChIKey | DCSOGNVTUJNZAM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|