C13H15Cl2FN2O2 — CID 43393315
(2,4-dichloro-5-fluorophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone (PubChem CID 43393315) has the molecular formula C13H15Cl2FN2O2 and a molecular weight of 321.18 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43393315 |
| Molecular Formula | C13H15Cl2FN2O2 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-[4-(2-hydroxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1Cl)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H15Cl2FN2O2/c14-10-8-11(15)12(16)7-9(10)13(20)18-3-1-17(2-4-18)5-6-19/h7-8,19H,1-6H2 |
| InChIKey | GNAJTAABWOVDCT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|