C17H15Cl2FN2O2S — CID 52719292
[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 52719292) has the molecular formula C17H15Cl2FN2O2S and a molecular weight of 401.29 g/mol. Its IUPAC name is [4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 52719292 |
| Molecular Formula | C17H15Cl2FN2O2S |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)c3cc(F)c(Cl)cc3Cl)CC2)s1 |
| InChI | InChI=1S/C17H15Cl2FN2O2S/c1-10-2-3-15(25-10)17(24)22-6-4-21(5-7-22)16(23)11-8-14(20)13(19)9-12(11)18/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | NDQNDHQYZGGMQA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|