C10H13NO2S — CID 59130289
(5-methylthiophen-2-yl)-morpholin-4-ylmethanone (PubChem CID 59130289) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is (5-methylthiophen-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (5-methylthiophen-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59130289 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (5-methylthiophen-2-yl)-morpholin-4-ylmethanone |
| SMILES | Cc1ccc(C(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C10H13NO2S/c1-8-2-3-9(14-8)10(12)11-4-6-13-7-5-11/h2-3H,4-7H2,1H3 |
| InChIKey | VFRHJBKHEQZRJM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |