C20H22N2O4S — CID 35328091
4-(5-methylthiophen-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-4-oxobutanamide (PubChem CID 35328091) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-4-oxobutanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 35328091 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-N-[2-(morpholine-4-carbonyl)phenyl]-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccccc2C(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C20H22N2O4S/c1-14-6-8-18(27-14)17(23)7-9-19(24)21-16-5-3-2-4-15(16)20(25)22-10-12-26-13-11-22/h2-6,8H,7,9-13H2,1H3,(H,21,24) |
| InChIKey | KHCHVZLBQMZDSM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |