C15H14ClNO2S — CID 39754436
N-(2-chlorophenyl)-4-(5-methylthiophen-2-yl)-4-oxobutanamide (PubChem CID 39754436) has the molecular formula C15H14ClNO2S and a molecular weight of 307.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(5-methylthiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-(2-chlorophenyl)-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 39754436 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(2-chlorophenyl)-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccccc2Cl)s1 |
| InChI | InChI=1S/C15H14ClNO2S/c1-10-6-8-14(20-10)13(18)7-9-15(19)17-12-5-3-2-4-11(12)16/h2-6,8H,7,9H2,1H3,(H,17,19) |
| InChIKey | JHWVUYKZPZDNTI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |