C16H14F3NO2S2 — CID 78878756
4-(5-methylthiophen-2-yl)-4-oxo-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide (PubChem CID 78878756) has the molecular formula C16H14F3NO2S2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-4-oxo-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 78878756 |
| Molecular Formula | C16H14F3NO2S2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccccc2SC(F)(F)F)s1 |
| InChI | InChI=1S/C16H14F3NO2S2/c1-10-6-8-14(23-10)12(21)7-9-15(22)20-11-4-2-3-5-13(11)24-16(17,18)19/h2-6,8H,7,9H2,1H3,(H,20,22) |
| InChIKey | TWDJUTYMLLNZEQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |