C18H21NO3S — CID 30235975
4-(5-methylthiophen-2-yl)-4-oxo-N-(2-propoxyphenyl)butanamide (PubChem CID 30235975) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-4-oxo-N-(2-propoxyphenyl)butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-(2-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 30235975 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-(2-propoxyphenyl)butanamide |
| SMILES | CCCOc1ccccc1NC(=O)CCC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C18H21NO3S/c1-3-12-22-16-7-5-4-6-14(16)19-18(21)11-9-15(20)17-10-8-13(2)23-17/h4-8,10H,3,9,11-12H2,1-2H3,(H,19,21) |
| InChIKey | AFOGTNCKOLZCCU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |