C22H27NO5S — CID 55950666
N-[2-(2-methoxyethoxy)-4-methylphenyl]-7-(5-methylthiophen-2-yl)-4,7-dioxoheptanamide (PubChem CID 55950666) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-4-methylphenyl]-7-(5-methylthiophen-2-yl)-4,7-dioxoheptanamide.
| Compound Name | N-[2-(2-methoxyethoxy)-4-methylphenyl]-7-(5-methylthiophen-2-yl)-4,7-dioxoheptanamide |
|---|---|
| PubChem CID | 55950666 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-4-methylphenyl]-7-(5-methylthiophen-2-yl)-4,7-dioxoheptanamide |
| SMILES | COCCOc1cc(C)ccc1NC(=O)CCC(=O)CCC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C22H27NO5S/c1-15-4-8-18(20(14-15)28-13-12-27-3)23-22(26)11-7-17(24)6-9-19(25)21-10-5-16(2)29-21/h4-5,8,10,14H,6-7,9,11-13H2,1-3H3,(H,23,26) |
| InChIKey | CPSWRXWRDAOLMT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|