C15H17BrN2OS2 — CID 51177010
[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 51177010) has the molecular formula C15H17BrN2OS2 and a molecular weight of 385.35 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 51177010 |
| Molecular Formula | C15H17BrN2OS2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3ccc(Br)s3)CC2)s1 |
| InChI | InChI=1S/C15H17BrN2OS2/c1-11-2-4-13(20-11)15(19)18-8-6-17(7-9-18)10-12-3-5-14(16)21-12/h2-5H,6-10H2,1H3 |
| InChIKey | OVZHCXDECYPVSD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |