C18H21BrN2O2S — CID 9100176
[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-[4-(methoxymethyl)phenyl]methanone (PubChem CID 9100176) has the molecular formula C18H21BrN2O2S and a molecular weight of 409.35 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-[4-(methoxymethyl)phenyl]methanone.
| Compound Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-[4-(methoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 9100176 |
| Molecular Formula | C18H21BrN2O2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-[4-(methoxymethyl)phenyl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCN(Cc3ccc(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C18H21BrN2O2S/c1-23-13-14-2-4-15(5-3-14)18(22)21-10-8-20(9-11-21)12-16-6-7-17(19)24-16/h2-7H,8-13H2,1H3 |
| InChIKey | GYWKBYATUXZZJQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |