C16H18BrN3OS — CID 119832810
(3-aminophenyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 119832810) has the molecular formula C16H18BrN3OS and a molecular weight of 380.31 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-aminophenyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119832810 |
| Molecular Formula | C16H18BrN3OS |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (3-aminophenyl)-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Nc1cccc(C(=O)N2CCN(Cc3ccc(Br)s3)CC2)c1 |
| InChI | InChI=1S/C16H18BrN3OS/c17-15-5-4-14(22-15)11-19-6-8-20(9-7-19)16(21)12-2-1-3-13(18)10-12/h1-5,10H,6-9,11,18H2 |
| InChIKey | PFWGRNVQTOCDRV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|