C16H15BrClFN2OS — CID 55415388
[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-chloro-2-fluorophenyl)methanone (PubChem CID 55415388) has the molecular formula C16H15BrClFN2OS and a molecular weight of 417.73 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-chloro-2-fluorophenyl)methanone.
| Compound Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-chloro-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 55415388 |
| Molecular Formula | C16H15BrClFN2OS |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(5-chloro-2-fluorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1F)N1CCN(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C16H15BrClFN2OS/c17-15-4-2-12(23-15)10-20-5-7-21(8-6-20)16(22)13-9-11(18)1-3-14(13)19/h1-4,9H,5-8,10H2 |
| InChIKey | QIHLUDWNAMUJGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |