C18H17BrClFN2O — CID 8642632
(5-bromo-2-fluorophenyl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 8642632) has the molecular formula C18H17BrClFN2O and a molecular weight of 411.70 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (5-bromo-2-fluorophenyl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 8642632 |
| Molecular Formula | C18H17BrClFN2O |
| Molecular Weight | 411.70 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)ccc1F)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17BrClFN2O/c19-14-4-5-17(21)16(11-14)18(24)23-8-6-22(7-9-23)12-13-2-1-3-15(20)10-13/h1-5,10-11H,6-9,12H2 |
| InChIKey | OIPAFKSNYNVIPP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |