C25H24BrClN2O2 — CID 19323572
[3-[(3-bromophenoxy)methyl]phenyl]-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19323572) has the molecular formula C25H24BrClN2O2 and a molecular weight of 499.84 g/mol. Its IUPAC name is [3-[(3-bromophenoxy)methyl]phenyl]-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3-[(3-bromophenoxy)methyl]phenyl]-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19323572 |
| Molecular Formula | C25H24BrClN2O2 |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [3-[(3-bromophenoxy)methyl]phenyl]-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(COc2cccc(Br)c2)c1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H24BrClN2O2/c26-22-7-3-9-24(16-22)31-18-20-5-1-6-21(14-20)25(30)29-12-10-28(11-13-29)17-19-4-2-8-23(27)15-19/h1-9,14-16H,10-13,17-18H2 |
| InChIKey | BOOFUJVJEDSIGC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |