C23H23BrN2O3 — CID 19572425
[3-[(3-bromophenoxy)methyl]phenyl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 19572425) has the molecular formula C23H23BrN2O3 and a molecular weight of 455.35 g/mol. Its IUPAC name is [3-[(3-bromophenoxy)methyl]phenyl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [3-[(3-bromophenoxy)methyl]phenyl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19572425 |
| Molecular Formula | C23H23BrN2O3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | [3-[(3-bromophenoxy)methyl]phenyl]-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(COc2cccc(Br)c2)c1)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C23H23BrN2O3/c24-20-6-2-7-21(15-20)29-17-18-4-1-5-19(14-18)23(27)26-11-9-25(10-12-26)16-22-8-3-13-28-22/h1-8,13-15H,9-12,16-17H2 |
| InChIKey | UWRGSGCXRCLXIG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |