C16H17FN2O3 — CID 154863760
(3-fluoro-4-hydroxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 154863760) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is (3-fluoro-4-hydroxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3-fluoro-4-hydroxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 154863760 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3-fluoro-4-hydroxyphenyl)-[4-(furan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(O)c(F)c1)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C16H17FN2O3/c17-14-10-12(3-4-15(14)20)16(21)19-7-5-18(6-8-19)11-13-2-1-9-22-13/h1-4,9-10,20H,5-8,11H2 |
| InChIKey | XLIZFWQRQNCCKH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |